C21H19F3N4O3S — CID 46813222
2-[1-(2,5-dimethylphenyl)imidazol-2-yl]sulfanyl-N-[4-nitro-2-(trifluoromethyl)phenyl]propanamide (PubChem CID 46813222) has the molecular formula C21H19F3N4O3S and a molecular weight of 464.47 g/mol. Its IUPAC name is 2-[1-(2,5-dimethylphenyl)imidazol-2-yl]sulfanyl-N-[4-nitro-2-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 2-[1-(2,5-dimethylphenyl)imidazol-2-yl]sulfanyl-N-[4-nitro-2-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 46813222 |
| Molecular Formula | C21H19F3N4O3S |
| Molecular Weight | 464.47 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | 2-[1-(2,5-dimethylphenyl)imidazol-2-yl]sulfanyl-N-[4-nitro-2-(trifluoromethyl)phenyl]propanamide |
| SMILES | Cc1ccc(C)c(-n2ccnc2SC(C)C(=O)Nc2ccc([N+](=O)[O-])cc2C(F)(F)F)c1 |
| InChI | InChI=1S/C21H19F3N4O3S/c1-12-4-5-13(2)18(10-12)27-9-8-25-20(27)32-14(3)19(29)26-17-7-6-15(28(30)31)11-16(17)21(22,23)24/h4-11,14H,1-3H3,(H,26,29) |
| InChIKey | ALWGFDLRMNXUJM-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.47 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|