C19H14ClF3N4O3S — CID 46811455
2-[1-(3-chlorophenyl)imidazol-2-yl]sulfanyl-N-[4-nitro-2-(trifluoromethyl)phenyl]propanamide (PubChem CID 46811455) has the molecular formula C19H14ClF3N4O3S and a molecular weight of 470.86 g/mol. Its IUPAC name is 2-[1-(3-chlorophenyl)imidazol-2-yl]sulfanyl-N-[4-nitro-2-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 2-[1-(3-chlorophenyl)imidazol-2-yl]sulfanyl-N-[4-nitro-2-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 46811455 |
| Molecular Formula | C19H14ClF3N4O3S |
| Molecular Weight | 470.86 g/mol |
| Exact Mass | 470.04 |
| IUPAC Name | 2-[1-(3-chlorophenyl)imidazol-2-yl]sulfanyl-N-[4-nitro-2-(trifluoromethyl)phenyl]propanamide |
| SMILES | CC(Sc1nccn1-c1cccc(Cl)c1)C(=O)Nc1ccc([N+](=O)[O-])cc1C(F)(F)F |
| InChI | InChI=1S/C19H14ClF3N4O3S/c1-11(31-18-24-7-8-26(18)13-4-2-3-12(20)9-13)17(28)25-16-6-5-14(27(29)30)10-15(16)19(21,22)23/h2-11H,1H3,(H,25,28) |
| InChIKey | NELAVFNNTIKPMX-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.86 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|