C12H11F3N6O3S — CID 8021952
(2S)-2-(1-methyltetrazol-5-yl)sulfanyl-N-[4-nitro-2-(trifluoromethyl)phenyl]propanamide (PubChem CID 8021952) has the molecular formula C12H11F3N6O3S and a molecular weight of 376.32 g/mol. Its IUPAC name is (2S)-2-(1-methyltetrazol-5-yl)sulfanyl-N-[4-nitro-2-(trifluoromethyl)phenyl]propanamide.
| Compound Name | (2S)-2-(1-methyltetrazol-5-yl)sulfanyl-N-[4-nitro-2-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 8021952 |
| Molecular Formula | C12H11F3N6O3S |
| Molecular Weight | 376.32 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | (2S)-2-(1-methyltetrazol-5-yl)sulfanyl-N-[4-nitro-2-(trifluoromethyl)phenyl]propanamide |
| SMILES | C[C@H](Sc1nnnn1C)C(=O)Nc1ccc([N+](=O)[O-])cc1C(F)(F)F |
| InChI | InChI=1S/C12H11F3N6O3S/c1-6(25-11-17-18-19-20(11)2)10(22)16-9-4-3-7(21(23)24)5-8(9)12(13,14)15/h3-6H,1-2H3,(H,16,22)/t6-/m0/s1 |
| InChIKey | PAZFKBFSQQCHKQ-LURJTMIESA-N |
| XLogP | 2.26 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.32 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|