C14H17ClN6O3S — CID 46639090
2-(1-tert-butyltetrazol-5-yl)sulfanyl-N-(2-chloro-5-nitrophenyl)propanamide (PubChem CID 46639090) has the molecular formula C14H17ClN6O3S and a molecular weight of 384.85 g/mol. Its IUPAC name is 2-(1-tert-butyltetrazol-5-yl)sulfanyl-N-(2-chloro-5-nitrophenyl)propanamide.
| Compound Name | 2-(1-tert-butyltetrazol-5-yl)sulfanyl-N-(2-chloro-5-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 46639090 |
| Molecular Formula | C14H17ClN6O3S |
| Molecular Weight | 384.85 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | 2-(1-tert-butyltetrazol-5-yl)sulfanyl-N-(2-chloro-5-nitrophenyl)propanamide |
| SMILES | CC(Sc1nnnn1C(C)(C)C)C(=O)Nc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C14H17ClN6O3S/c1-8(25-13-17-18-19-20(13)14(2,3)4)12(22)16-11-7-9(21(23)24)5-6-10(11)15/h5-8H,1-4H3,(H,16,22) |
| InChIKey | RRVSHLUOMYDCIX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.85 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|