C11H10ClN5O3S — CID 8933220
(2S)-N-(2-chloro-5-nitrophenyl)-2-(1H-1,2,4-triazol-5-ylsulfanyl)propanamide (PubChem CID 8933220) has the molecular formula C11H10ClN5O3S and a molecular weight of 327.75 g/mol. Its IUPAC name is (2S)-N-(2-chloro-5-nitrophenyl)-2-(1H-1,2,4-triazol-5-ylsulfanyl)propanamide.
| Compound Name | (2S)-N-(2-chloro-5-nitrophenyl)-2-(1H-1,2,4-triazol-5-ylsulfanyl)propanamide |
|---|---|
| PubChem CID | 8933220 |
| Molecular Formula | C11H10ClN5O3S |
| Molecular Weight | 327.75 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | (2S)-N-(2-chloro-5-nitrophenyl)-2-(1H-1,2,4-triazol-5-ylsulfanyl)propanamide |
| SMILES | C[C@H](Sc1ncn[nH]1)C(=O)Nc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C11H10ClN5O3S/c1-6(21-11-13-5-14-16-11)10(18)15-9-4-7(17(19)20)2-3-8(9)12/h2-6H,1H3,(H,15,18)(H,13,14,16)/t6-/m0/s1 |
| InChIKey | OVUXXEKEUWOYPV-LURJTMIESA-N |
| XLogP | 2.49 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.75 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|