C10H7ClN6O4 — CID 108513541
N-(2-chloro-5-nitrophenyl)-N'-(1H-1,2,4-triazol-5-yl)oxamide (PubChem CID 108513541) has the molecular formula C10H7ClN6O4 and a molecular weight of 310.66 g/mol. Its IUPAC name is N-(2-chloro-5-nitrophenyl)-N'-(1H-1,2,4-triazol-5-yl)oxamide.
| Compound Name | N-(2-chloro-5-nitrophenyl)-N'-(1H-1,2,4-triazol-5-yl)oxamide |
|---|---|
| PubChem CID | 108513541 |
| Molecular Formula | C10H7ClN6O4 |
| Molecular Weight | 310.66 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | N-(2-chloro-5-nitrophenyl)-N'-(1H-1,2,4-triazol-5-yl)oxamide |
| SMILES | O=C(Nc1ncn[nH]1)C(=O)Nc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C10H7ClN6O4/c11-6-2-1-5(17(20)21)3-7(6)14-8(18)9(19)15-10-12-4-13-16-10/h1-4H,(H,14,18)(H2,12,13,15,16,19) |
| InChIKey | QMIXGIDGAWUTQE-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 142.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.66 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|