C14H8ClF2N3O4 — CID 108513618
N-(2-chloro-5-nitrophenyl)-N'-(2,5-difluorophenyl)oxamide (PubChem CID 108513618) has the molecular formula C14H8ClF2N3O4 and a molecular weight of 355.68 g/mol. Its IUPAC name is N-(2-chloro-5-nitrophenyl)-N'-(2,5-difluorophenyl)oxamide.
| Compound Name | N-(2-chloro-5-nitrophenyl)-N'-(2,5-difluorophenyl)oxamide |
|---|---|
| PubChem CID | 108513618 |
| Molecular Formula | C14H8ClF2N3O4 |
| Molecular Weight | 355.68 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | N-(2-chloro-5-nitrophenyl)-N'-(2,5-difluorophenyl)oxamide |
| SMILES | O=C(Nc1cc(F)ccc1F)C(=O)Nc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C14H8ClF2N3O4/c15-9-3-2-8(20(23)24)6-11(9)18-13(21)14(22)19-12-5-7(16)1-4-10(12)17/h1-6H,(H,18,21)(H,19,22) |
| InChIKey | STXCVTDZHTVVHC-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.68 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|