C13H4ClF5N2O3 — CID 3483393
N-(2-chloro-5-nitrophenyl)-2,3,4,5,6-pentafluorobenzamide (PubChem CID 3483393) has the molecular formula C13H4ClF5N2O3 and a molecular weight of 366.63 g/mol. Its IUPAC name is N-(2-chloro-5-nitrophenyl)-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-(2-chloro-5-nitrophenyl)-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 3483393 |
| Molecular Formula | C13H4ClF5N2O3 |
| Molecular Weight | 366.63 g/mol |
| Exact Mass | 365.98 |
| IUPAC Name | N-(2-chloro-5-nitrophenyl)-2,3,4,5,6-pentafluorobenzamide |
| SMILES | O=C(Nc1cc([N+](=O)[O-])ccc1Cl)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H4ClF5N2O3/c14-5-2-1-4(21(23)24)3-6(5)20-13(22)7-8(15)10(17)12(19)11(18)9(7)16/h1-3H,(H,20,22) |
| InChIKey | TUGQTVUBMSOMKB-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.63 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|