C14H7Cl2F2N3O4 — CID 11567289
2-chloro-N-[(2-chloro-5-nitrophenyl)carbamoyl]-4,5-difluorobenzamide (PubChem CID 11567289) has the molecular formula C14H7Cl2F2N3O4 and a molecular weight of 390.13 g/mol. Its IUPAC name is 2-chloro-N-[(2-chloro-5-nitrophenyl)carbamoyl]-4,5-difluorobenzamide.
| Compound Name | 2-chloro-N-[(2-chloro-5-nitrophenyl)carbamoyl]-4,5-difluorobenzamide |
|---|---|
| PubChem CID | 11567289 |
| Molecular Formula | C14H7Cl2F2N3O4 |
| Molecular Weight | 390.13 g/mol |
| Exact Mass | 388.98 |
| IUPAC Name | 2-chloro-N-[(2-chloro-5-nitrophenyl)carbamoyl]-4,5-difluorobenzamide |
| SMILES | O=C(NC(=O)c1cc(F)c(F)cc1Cl)Nc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C14H7Cl2F2N3O4/c15-8-2-1-6(21(24)25)3-12(8)19-14(23)20-13(22)7-4-10(17)11(18)5-9(7)16/h1-5H,(H2,19,20,22,23) |
| InChIKey | IUBFMVVYTMOVOK-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.13 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|