C15H11Cl2F2N3O3 — CID 2845121
2-chloro-N-[2-(2-chloro-4-nitroanilino)ethyl]-4,5-difluorobenzamide (PubChem CID 2845121) has the molecular formula C15H11Cl2F2N3O3 and a molecular weight of 390.17 g/mol. Its IUPAC name is 2-chloro-N-[2-(2-chloro-4-nitroanilino)ethyl]-4,5-difluorobenzamide.
| Compound Name | 2-chloro-N-[2-(2-chloro-4-nitroanilino)ethyl]-4,5-difluorobenzamide |
|---|---|
| PubChem CID | 2845121 |
| Molecular Formula | C15H11Cl2F2N3O3 |
| Molecular Weight | 390.17 g/mol |
| Exact Mass | 389.01 |
| IUPAC Name | 2-chloro-N-[2-(2-chloro-4-nitroanilino)ethyl]-4,5-difluorobenzamide |
| SMILES | O=C(NCCNc1ccc([N+](=O)[O-])cc1Cl)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C15H11Cl2F2N3O3/c16-10-7-13(19)12(18)6-9(10)15(23)21-4-3-20-14-2-1-8(22(24)25)5-11(14)17/h1-2,5-7,20H,3-4H2,(H,21,23) |
| InChIKey | AMAJBGDNDWMKGP-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.17 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|