C14H8Cl2FN3O3S — CID 3966361
2,4-dichloro-N-[(2-fluoro-5-nitrophenyl)carbamothioyl]benzamide (PubChem CID 3966361) has the molecular formula C14H8Cl2FN3O3S and a molecular weight of 388.21 g/mol. Its IUPAC name is 2,4-dichloro-N-[(2-fluoro-5-nitrophenyl)carbamothioyl]benzamide.
| Compound Name | 2,4-dichloro-N-[(2-fluoro-5-nitrophenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 3966361 |
| Molecular Formula | C14H8Cl2FN3O3S |
| Molecular Weight | 388.21 g/mol |
| Exact Mass | 386.96 |
| IUPAC Name | 2,4-dichloro-N-[(2-fluoro-5-nitrophenyl)carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1cc([N+](=O)[O-])ccc1F)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H8Cl2FN3O3S/c15-7-1-3-9(10(16)5-7)13(21)19-14(24)18-12-6-8(20(22)23)2-4-11(12)17/h1-6H,(H2,18,19,21,24) |
| InChIKey | RWUXDAJKISJWIE-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.21 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|