C15H9Cl2N3O5S — CID 2190135
4-chloro-3-[(2-chloro-4-nitrobenzoyl)carbamothioylamino]benzoic acid (PubChem CID 2190135) has the molecular formula C15H9Cl2N3O5S and a molecular weight of 414.23 g/mol. Its IUPAC name is 4-chloro-3-[(2-chloro-4-nitrobenzoyl)carbamothioylamino]benzoic acid.
| Compound Name | 4-chloro-3-[(2-chloro-4-nitrobenzoyl)carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 2190135 |
| Molecular Formula | C15H9Cl2N3O5S |
| Molecular Weight | 414.23 g/mol |
| Exact Mass | 412.96 |
| IUPAC Name | 4-chloro-3-[(2-chloro-4-nitrobenzoyl)carbamothioylamino]benzoic acid |
| SMILES | O=C(O)c1ccc(Cl)c(NC(=S)NC(=O)c2ccc([N+](=O)[O-])cc2Cl)c1 |
| InChI | InChI=1S/C15H9Cl2N3O5S/c16-10-4-1-7(14(22)23)5-12(10)18-15(26)19-13(21)9-3-2-8(20(24)25)6-11(9)17/h1-6H,(H,22,23)(H2,18,19,21,26) |
| InChIKey | IFAUOHUEYWGYEM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 121.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.23 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|