C15H12ClN3O3S — CID 801902
N-[(2-chloro-5-nitrophenyl)carbamothioyl]-4-methylbenzamide (PubChem CID 801902) has the molecular formula C15H12ClN3O3S and a molecular weight of 349.80 g/mol. Its IUPAC name is N-[(2-chloro-5-nitrophenyl)carbamothioyl]-4-methylbenzamide.
| Compound Name | N-[(2-chloro-5-nitrophenyl)carbamothioyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 801902 |
| Molecular Formula | C15H12ClN3O3S |
| Molecular Weight | 349.80 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | N-[(2-chloro-5-nitrophenyl)carbamothioyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC(=S)Nc2cc([N+](=O)[O-])ccc2Cl)cc1 |
| InChI | InChI=1S/C15H12ClN3O3S/c1-9-2-4-10(5-3-9)14(20)18-15(23)17-13-8-11(19(21)22)6-7-12(13)16/h2-8H,1H3,(H2,17,18,20,23) |
| InChIKey | BXODPCBGIFYSCZ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.80 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|