C16H14FN3O5S — CID 19629420
N-[(2-fluoro-5-nitrophenyl)carbamothioyl]-2,6-dimethoxybenzamide (PubChem CID 19629420) has the molecular formula C16H14FN3O5S and a molecular weight of 379.37 g/mol. Its IUPAC name is N-[(2-fluoro-5-nitrophenyl)carbamothioyl]-2,6-dimethoxybenzamide.
| Compound Name | N-[(2-fluoro-5-nitrophenyl)carbamothioyl]-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 19629420 |
| Molecular Formula | C16H14FN3O5S |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | N-[(2-fluoro-5-nitrophenyl)carbamothioyl]-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)NC(=S)Nc1cc([N+](=O)[O-])ccc1F |
| InChI | InChI=1S/C16H14FN3O5S/c1-24-12-4-3-5-13(25-2)14(12)15(21)19-16(26)18-11-8-9(20(22)23)6-7-10(11)17/h3-8H,1-2H3,(H2,18,19,21,26) |
| InChIKey | BJVYIAPZWQGTNE-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|