C14H10Cl2N4O4S — CID 9096982
1-[(5-chloro-2-hydroxybenzoyl)amino]-3-(2-chloro-5-nitrophenyl)thiourea (PubChem CID 9096982) has the molecular formula C14H10Cl2N4O4S and a molecular weight of 401.23 g/mol. Its IUPAC name is 1-[(5-chloro-2-hydroxybenzoyl)amino]-3-(2-chloro-5-nitrophenyl)thiourea.
| Compound Name | 1-[(5-chloro-2-hydroxybenzoyl)amino]-3-(2-chloro-5-nitrophenyl)thiourea |
|---|---|
| PubChem CID | 9096982 |
| Molecular Formula | C14H10Cl2N4O4S |
| Molecular Weight | 401.23 g/mol |
| Exact Mass | 399.98 |
| IUPAC Name | 1-[(5-chloro-2-hydroxybenzoyl)amino]-3-(2-chloro-5-nitrophenyl)thiourea |
| SMILES | O=C(NNC(=S)Nc1cc([N+](=O)[O-])ccc1Cl)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C14H10Cl2N4O4S/c15-7-1-4-12(21)9(5-7)13(22)18-19-14(25)17-11-6-8(20(23)24)2-3-10(11)16/h1-6,21H,(H,18,22)(H2,17,19,25) |
| InChIKey | GFBRAMMVMPNOEG-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 116.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.23 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|