C14H11ClFN3O2S — CID 9096936
1-[(5-chloro-2-hydroxybenzoyl)amino]-3-(4-fluorophenyl)thiourea (PubChem CID 9096936) has the molecular formula C14H11ClFN3O2S and a molecular weight of 339.78 g/mol. Its IUPAC name is 1-[(5-chloro-2-hydroxybenzoyl)amino]-3-(4-fluorophenyl)thiourea.
| Compound Name | 1-[(5-chloro-2-hydroxybenzoyl)amino]-3-(4-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 9096936 |
| Molecular Formula | C14H11ClFN3O2S |
| Molecular Weight | 339.78 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | 1-[(5-chloro-2-hydroxybenzoyl)amino]-3-(4-fluorophenyl)thiourea |
| SMILES | O=C(NNC(=S)Nc1ccc(F)cc1)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C14H11ClFN3O2S/c15-8-1-6-12(20)11(7-8)13(21)18-19-14(22)17-10-4-2-9(16)3-5-10/h1-7,20H,(H,18,21)(H2,17,19,22) |
| InChIKey | CQCWXOPVCOUFHR-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.78 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|