C16H14F2N6O2S2 — CID 18270236
1-(4-fluorophenyl)-3-[[2-[2-[(4-fluorophenyl)carbamothioyl]hydrazinyl]-2-oxoacetyl]amino]thiourea (PubChem CID 18270236) has the molecular formula C16H14F2N6O2S2 and a molecular weight of 424.46 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[[2-[2-[(4-fluorophenyl)carbamothioyl]hydrazinyl]-2-oxoacetyl]amino]thiourea.
| Compound Name | 1-(4-fluorophenyl)-3-[[2-[2-[(4-fluorophenyl)carbamothioyl]hydrazinyl]-2-oxoacetyl]amino]thiourea |
|---|---|
| PubChem CID | 18270236 |
| Molecular Formula | C16H14F2N6O2S2 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[[2-[2-[(4-fluorophenyl)carbamothioyl]hydrazinyl]-2-oxoacetyl]amino]thiourea |
| SMILES | O=C(NNC(=S)Nc1ccc(F)cc1)C(=O)NNC(=S)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C16H14F2N6O2S2/c17-9-1-5-11(6-2-9)19-15(27)23-21-13(25)14(26)22-24-16(28)20-12-7-3-10(18)4-8-12/h1-8H,(H,21,25)(H,22,26)(H2,19,23,27)(H2,20,24,28) |
| InChIKey | WWLCVMHYRWJONK-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 106.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|