C16H14FN3OS — CID 9469508
1-(4-fluorophenyl)-3-[[(E)-3-phenylprop-2-enoyl]amino]thiourea (PubChem CID 9469508) has the molecular formula C16H14FN3OS and a molecular weight of 315.37 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[[(E)-3-phenylprop-2-enoyl]amino]thiourea.
| Compound Name | 1-(4-fluorophenyl)-3-[[(E)-3-phenylprop-2-enoyl]amino]thiourea |
|---|---|
| PubChem CID | 9469508 |
| Molecular Formula | C16H14FN3OS |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[[(E)-3-phenylprop-2-enoyl]amino]thiourea |
| SMILES | O=C(/C=C/c1ccccc1)NNC(=S)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C16H14FN3OS/c17-13-7-9-14(10-8-13)18-16(22)20-19-15(21)11-6-12-4-2-1-3-5-12/h1-11H,(H,19,21)(H2,18,20,22)/b11-6+ |
| InChIKey | BIKIEXJYLNRJJL-IZZDOVSWSA-N |
| XLogP | 2.86 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|