C22H18FN3OS — CID 6308023
(E)-N-[(4-anilinophenyl)carbamothioyl]-3-(4-fluorophenyl)prop-2-enamide (PubChem CID 6308023) has the molecular formula C22H18FN3OS and a molecular weight of 391.47 g/mol. Its IUPAC name is (E)-N-[(4-anilinophenyl)carbamothioyl]-3-(4-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[(4-anilinophenyl)carbamothioyl]-3-(4-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 6308023 |
| Molecular Formula | C22H18FN3OS |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | (E)-N-[(4-anilinophenyl)carbamothioyl]-3-(4-fluorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(F)cc1)NC(=S)Nc1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C22H18FN3OS/c23-17-9-6-16(7-10-17)8-15-21(27)26-22(28)25-20-13-11-19(12-14-20)24-18-4-2-1-3-5-18/h1-15,24H,(H2,25,26,27,28)/b15-8+ |
| InChIKey | BOPZOCBTUZPYGB-OVCLIPMQSA-N |
| XLogP | 5.10 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|