C29H23FN4O2S — CID 4942159
N-(4-anilinophenyl)-2-[3-(4-fluorophenyl)prop-2-enoylcarbamothioylamino]benzamide (PubChem CID 4942159) has the molecular formula C29H23FN4O2S and a molecular weight of 510.59 g/mol. Its IUPAC name is N-(4-anilinophenyl)-2-[3-(4-fluorophenyl)prop-2-enoylcarbamothioylamino]benzamide.
| Compound Name | N-(4-anilinophenyl)-2-[3-(4-fluorophenyl)prop-2-enoylcarbamothioylamino]benzamide |
|---|---|
| PubChem CID | 4942159 |
| Molecular Formula | C29H23FN4O2S |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | N-(4-anilinophenyl)-2-[3-(4-fluorophenyl)prop-2-enoylcarbamothioylamino]benzamide |
| SMILES | O=C(C=Cc1ccc(F)cc1)NC(=S)Nc1ccccc1C(=O)Nc1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C29H23FN4O2S/c30-21-13-10-20(11-14-21)12-19-27(35)34-29(37)33-26-9-5-4-8-25(26)28(36)32-24-17-15-23(16-18-24)31-22-6-2-1-3-7-22/h1-19,31H,(H,32,36)(H2,33,34,35,37) |
| InChIKey | YYRJIVOHFPIAAN-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|