C23H18ClN3O2S — CID 4508292
2-[3-(2-chlorophenyl)prop-2-enoylcarbamothioylamino]-N-phenylbenzamide (PubChem CID 4508292) has the molecular formula C23H18ClN3O2S and a molecular weight of 435.94 g/mol. Its IUPAC name is 2-[3-(2-chlorophenyl)prop-2-enoylcarbamothioylamino]-N-phenylbenzamide.
| Compound Name | 2-[3-(2-chlorophenyl)prop-2-enoylcarbamothioylamino]-N-phenylbenzamide |
|---|---|
| PubChem CID | 4508292 |
| Molecular Formula | C23H18ClN3O2S |
| Molecular Weight | 435.94 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | 2-[3-(2-chlorophenyl)prop-2-enoylcarbamothioylamino]-N-phenylbenzamide |
| SMILES | O=C(C=Cc1ccccc1Cl)NC(=S)Nc1ccccc1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C23H18ClN3O2S/c24-19-12-6-4-8-16(19)14-15-21(28)27-23(30)26-20-13-7-5-11-18(20)22(29)25-17-9-2-1-3-10-17/h1-15H,(H,25,29)(H2,26,27,28,30) |
| InChIKey | YSQFXMMVRRRBLG-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.94 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|