C23H24ClN3O2S — CID 4938046
N-[[2-(azepane-1-carbonyl)phenyl]carbamothioyl]-3-(2-chlorophenyl)prop-2-enamide (PubChem CID 4938046) has the molecular formula C23H24ClN3O2S and a molecular weight of 441.98 g/mol. Its IUPAC name is N-[[2-(azepane-1-carbonyl)phenyl]carbamothioyl]-3-(2-chlorophenyl)prop-2-enamide.
| Compound Name | N-[[2-(azepane-1-carbonyl)phenyl]carbamothioyl]-3-(2-chlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4938046 |
| Molecular Formula | C23H24ClN3O2S |
| Molecular Weight | 441.98 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | N-[[2-(azepane-1-carbonyl)phenyl]carbamothioyl]-3-(2-chlorophenyl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccccc1Cl)NC(=S)Nc1ccccc1C(=O)N1CCCCCC1 |
| InChI | InChI=1S/C23H24ClN3O2S/c24-19-11-5-3-9-17(19)13-14-21(28)26-23(30)25-20-12-6-4-10-18(20)22(29)27-15-7-1-2-8-16-27/h3-6,9-14H,1-2,7-8,15-16H2,(H2,25,26,28,30) |
| InChIKey | HPABMXPGSRPRLN-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.98 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|