C20H18Cl2N2O2 — CID 1318837
3-(2,4-dichlorophenyl)-N-[2-(pyrrolidine-1-carbonyl)phenyl]prop-2-enamide (PubChem CID 1318837) has the molecular formula C20H18Cl2N2O2 and a molecular weight of 389.28 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-N-[2-(pyrrolidine-1-carbonyl)phenyl]prop-2-enamide.
| Compound Name | 3-(2,4-dichlorophenyl)-N-[2-(pyrrolidine-1-carbonyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 1318837 |
| Molecular Formula | C20H18Cl2N2O2 |
| Molecular Weight | 389.28 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-N-[2-(pyrrolidine-1-carbonyl)phenyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(Cl)cc1Cl)Nc1ccccc1C(=O)N1CCCC1 |
| InChI | InChI=1S/C20H18Cl2N2O2/c21-15-9-7-14(17(22)13-15)8-10-19(25)23-18-6-2-1-5-16(18)20(26)24-11-3-4-12-24/h1-2,5-10,13H,3-4,11-12H2,(H,23,25) |
| InChIKey | ANFBUYXZFHZUAU-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.28 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|