C21H21Cl2N3O2S — CID 4937958
N-[[2-(azepane-1-carbonyl)phenyl]carbamothioyl]-2,4-dichlorobenzamide (PubChem CID 4937958) has the molecular formula C21H21Cl2N3O2S and a molecular weight of 450.39 g/mol. Its IUPAC name is N-[[2-(azepane-1-carbonyl)phenyl]carbamothioyl]-2,4-dichlorobenzamide.
| Compound Name | N-[[2-(azepane-1-carbonyl)phenyl]carbamothioyl]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 4937958 |
| Molecular Formula | C21H21Cl2N3O2S |
| Molecular Weight | 450.39 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | N-[[2-(azepane-1-carbonyl)phenyl]carbamothioyl]-2,4-dichlorobenzamide |
| SMILES | O=C(NC(=S)Nc1ccccc1C(=O)N1CCCCCC1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H21Cl2N3O2S/c22-14-9-10-15(17(23)13-14)19(27)25-21(29)24-18-8-4-3-7-16(18)20(28)26-11-5-1-2-6-12-26/h3-4,7-10,13H,1-2,5-6,11-12H2,(H2,24,25,27,29) |
| InChIKey | LLODJEPIPUCNFK-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.39 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|