C20H19Cl2N3O2S — CID 17133828
3,5-dichloro-N-[[2-(piperidine-1-carbonyl)phenyl]carbamothioyl]benzamide (PubChem CID 17133828) has the molecular formula C20H19Cl2N3O2S and a molecular weight of 436.36 g/mol. Its IUPAC name is 3,5-dichloro-N-[[2-(piperidine-1-carbonyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 3,5-dichloro-N-[[2-(piperidine-1-carbonyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17133828 |
| Molecular Formula | C20H19Cl2N3O2S |
| Molecular Weight | 436.36 g/mol |
| Exact Mass | 435.06 |
| IUPAC Name | 3,5-dichloro-N-[[2-(piperidine-1-carbonyl)phenyl]carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1ccccc1C(=O)N1CCCCC1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C20H19Cl2N3O2S/c21-14-10-13(11-15(22)12-14)18(26)24-20(28)23-17-7-3-2-6-16(17)19(27)25-8-4-1-5-9-25/h2-3,6-7,10-12H,1,4-5,8-9H2,(H2,23,24,26,28) |
| InChIKey | WPFDNVKVMOCYAE-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.36 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|