C20H20BrN3O2S — CID 4932847
3-bromo-4-methyl-N-[[2-(pyrrolidine-1-carbonyl)phenyl]carbamothioyl]benzamide (PubChem CID 4932847) has the molecular formula C20H20BrN3O2S and a molecular weight of 446.37 g/mol. Its IUPAC name is 3-bromo-4-methyl-N-[[2-(pyrrolidine-1-carbonyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 3-bromo-4-methyl-N-[[2-(pyrrolidine-1-carbonyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4932847 |
| Molecular Formula | C20H20BrN3O2S |
| Molecular Weight | 446.37 g/mol |
| Exact Mass | 445.05 |
| IUPAC Name | 3-bromo-4-methyl-N-[[2-(pyrrolidine-1-carbonyl)phenyl]carbamothioyl]benzamide |
| SMILES | Cc1ccc(C(=O)NC(=S)Nc2ccccc2C(=O)N2CCCC2)cc1Br |
| InChI | InChI=1S/C20H20BrN3O2S/c1-13-8-9-14(12-16(13)21)18(25)23-20(27)22-17-7-3-2-6-15(17)19(26)24-10-4-5-11-24/h2-3,6-9,12H,4-5,10-11H2,1H3,(H2,22,23,25,27) |
| InChIKey | CCPKQNPCNXOZLL-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.37 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|