C20H20N4O4S — CID 4936132
3-nitro-N-[[2-(piperidine-1-carbonyl)phenyl]carbamothioyl]benzamide (PubChem CID 4936132) has the molecular formula C20H20N4O4S and a molecular weight of 412.47 g/mol. Its IUPAC name is 3-nitro-N-[[2-(piperidine-1-carbonyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 3-nitro-N-[[2-(piperidine-1-carbonyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4936132 |
| Molecular Formula | C20H20N4O4S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 3-nitro-N-[[2-(piperidine-1-carbonyl)phenyl]carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1ccccc1C(=O)N1CCCCC1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H20N4O4S/c25-18(14-7-6-8-15(13-14)24(27)28)22-20(29)21-17-10-3-2-9-16(17)19(26)23-11-4-1-5-12-23/h2-3,6-10,13H,1,4-5,11-12H2,(H2,21,22,25,29) |
| InChIKey | HQNLFWZXSUALSR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|