C25H21Cl2FN4O2S — CID 43913835
2,4-dichloro-N-[[4-[4-(2-fluorobenzoyl)piperazin-1-yl]phenyl]carbamothioyl]benzamide (PubChem CID 43913835) has the molecular formula C25H21Cl2FN4O2S and a molecular weight of 531.44 g/mol. Its IUPAC name is 2,4-dichloro-N-[[4-[4-(2-fluorobenzoyl)piperazin-1-yl]phenyl]carbamothioyl]benzamide.
| Compound Name | 2,4-dichloro-N-[[4-[4-(2-fluorobenzoyl)piperazin-1-yl]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 43913835 |
| Molecular Formula | C25H21Cl2FN4O2S |
| Molecular Weight | 531.44 g/mol |
| Exact Mass | 530.07 |
| IUPAC Name | 2,4-dichloro-N-[[4-[4-(2-fluorobenzoyl)piperazin-1-yl]phenyl]carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1ccc(N2CCN(C(=O)c3ccccc3F)CC2)cc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C25H21Cl2FN4O2S/c26-16-5-10-19(21(27)15-16)23(33)30-25(35)29-17-6-8-18(9-7-17)31-11-13-32(14-12-31)24(34)20-3-1-2-4-22(20)28/h1-10,15H,11-14H2,(H2,29,30,33,35) |
| InChIKey | PXTMXRQTTSNVJS-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.44 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|