C24H21F2N3O2 — CID 17273892
2-fluoro-N-[4-[4-(2-fluorobenzoyl)piperazin-1-yl]phenyl]benzamide (PubChem CID 17273892) has the molecular formula C24H21F2N3O2 and a molecular weight of 421.45 g/mol. Its IUPAC name is 2-fluoro-N-[4-[4-(2-fluorobenzoyl)piperazin-1-yl]phenyl]benzamide.
| Compound Name | 2-fluoro-N-[4-[4-(2-fluorobenzoyl)piperazin-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 17273892 |
| Molecular Formula | C24H21F2N3O2 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 2-fluoro-N-[4-[4-(2-fluorobenzoyl)piperazin-1-yl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(N2CCN(C(=O)c3ccccc3F)CC2)cc1)c1ccccc1F |
| InChI | InChI=1S/C24H21F2N3O2/c25-21-7-3-1-5-19(21)23(30)27-17-9-11-18(12-10-17)28-13-15-29(16-14-28)24(31)20-6-2-4-8-22(20)26/h1-12H,13-16H2,(H,27,30) |
| InChIKey | BXUNFCDFHQQIPJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|