C26H21ClFN3O2S — CID 17273895
3-chloro-N-[4-[4-(2-fluorobenzoyl)piperazin-1-yl]phenyl]-1-benzothiophene-2-carboxamide (PubChem CID 17273895) has the molecular formula C26H21ClFN3O2S and a molecular weight of 493.99 g/mol. Its IUPAC name is 3-chloro-N-[4-[4-(2-fluorobenzoyl)piperazin-1-yl]phenyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[4-[4-(2-fluorobenzoyl)piperazin-1-yl]phenyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 17273895 |
| Molecular Formula | C26H21ClFN3O2S |
| Molecular Weight | 493.99 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | 3-chloro-N-[4-[4-(2-fluorobenzoyl)piperazin-1-yl]phenyl]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCN(C(=O)c3ccccc3F)CC2)cc1)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C26H21ClFN3O2S/c27-23-20-6-2-4-8-22(20)34-24(23)25(32)29-17-9-11-18(12-10-17)30-13-15-31(16-14-30)26(33)19-5-1-3-7-21(19)28/h1-12H,13-16H2,(H,29,32) |
| InChIKey | PDOGGCXNYIAJBR-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.99 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|