C27H22Cl2N4O2S2 — CID 17317406
N-[[4-(4-benzoylpiperazin-1-yl)phenyl]carbamothioyl]-3,6-dichloro-1-benzothiophene-2-carboxamide (PubChem CID 17317406) has the molecular formula C27H22Cl2N4O2S2 and a molecular weight of 569.54 g/mol. Its IUPAC name is N-[[4-(4-benzoylpiperazin-1-yl)phenyl]carbamothioyl]-3,6-dichloro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[[4-(4-benzoylpiperazin-1-yl)phenyl]carbamothioyl]-3,6-dichloro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 17317406 |
| Molecular Formula | C27H22Cl2N4O2S2 |
| Molecular Weight | 569.54 g/mol |
| Exact Mass | 568.06 |
| IUPAC Name | N-[[4-(4-benzoylpiperazin-1-yl)phenyl]carbamothioyl]-3,6-dichloro-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccc(N2CCN(C(=O)c3ccccc3)CC2)cc1)c1sc2cc(Cl)ccc2c1Cl |
| InChI | InChI=1S/C27H22Cl2N4O2S2/c28-18-6-11-21-22(16-18)37-24(23(21)29)25(34)31-27(36)30-19-7-9-20(10-8-19)32-12-14-33(15-13-32)26(35)17-4-2-1-3-5-17/h1-11,16H,12-15H2,(H2,30,31,34,36) |
| InChIKey | RHXZHLLOZOSQCC-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.54 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|