C20H19Cl2N3O3S2 — CID 2004246
3,6-dichloro-N-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]-1-benzothiophene-2-carboxamide (PubChem CID 2004246) has the molecular formula C20H19Cl2N3O3S2 and a molecular weight of 484.43 g/mol. Its IUPAC name is 3,6-dichloro-N-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3,6-dichloro-N-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 2004246 |
| Molecular Formula | C20H19Cl2N3O3S2 |
| Molecular Weight | 484.43 g/mol |
| Exact Mass | 483.02 |
| IUPAC Name | 3,6-dichloro-N-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]-1-benzothiophene-2-carboxamide |
| SMILES | CS(=O)(=O)N1CCN(c2ccc(NC(=O)c3sc4cc(Cl)ccc4c3Cl)cc2)CC1 |
| InChI | InChI=1S/C20H19Cl2N3O3S2/c1-30(27,28)25-10-8-24(9-11-25)15-5-3-14(4-6-15)23-20(26)19-18(22)16-7-2-13(21)12-17(16)29-19/h2-7,12H,8-11H2,1H3,(H,23,26) |
| InChIKey | KZZLSJZRHUHCLE-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.43 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|