C23H22Cl3N3O2S — CID 4209353
N-[4-(4-butanoylpiperazin-1-yl)-3-chlorophenyl]-3,6-dichloro-1-benzothiophene-2-carboxamide (PubChem CID 4209353) has the molecular formula C23H22Cl3N3O2S and a molecular weight of 510.87 g/mol. Its IUPAC name is N-[4-(4-butanoylpiperazin-1-yl)-3-chlorophenyl]-3,6-dichloro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[4-(4-butanoylpiperazin-1-yl)-3-chlorophenyl]-3,6-dichloro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 4209353 |
| Molecular Formula | C23H22Cl3N3O2S |
| Molecular Weight | 510.87 g/mol |
| Exact Mass | 509.05 |
| IUPAC Name | N-[4-(4-butanoylpiperazin-1-yl)-3-chlorophenyl]-3,6-dichloro-1-benzothiophene-2-carboxamide |
| SMILES | CCCC(=O)N1CCN(c2ccc(NC(=O)c3sc4cc(Cl)ccc4c3Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C23H22Cl3N3O2S/c1-2-3-20(30)29-10-8-28(9-11-29)18-7-5-15(13-17(18)25)27-23(31)22-21(26)16-6-4-14(24)12-19(16)32-22/h4-7,12-13H,2-3,8-11H2,1H3,(H,27,31) |
| InChIKey | NWHMNJNRUDWWCO-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.87 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|