C24H23Cl3N4O2S2 — CID 17317643
N-[[4-(4-butanoylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-3,6-dichloro-1-benzothiophene-2-carboxamide (PubChem CID 17317643) has the molecular formula C24H23Cl3N4O2S2 and a molecular weight of 569.97 g/mol. Its IUPAC name is N-[[4-(4-butanoylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-3,6-dichloro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[[4-(4-butanoylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-3,6-dichloro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 17317643 |
| Molecular Formula | C24H23Cl3N4O2S2 |
| Molecular Weight | 569.97 g/mol |
| Exact Mass | 568.03 |
| IUPAC Name | N-[[4-(4-butanoylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-3,6-dichloro-1-benzothiophene-2-carboxamide |
| SMILES | CCCC(=O)N1CCN(c2ccc(NC(=S)NC(=O)c3sc4cc(Cl)ccc4c3Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C24H23Cl3N4O2S2/c1-2-3-20(32)31-10-8-30(9-11-31)18-7-5-15(13-17(18)26)28-24(34)29-23(33)22-21(27)16-6-4-14(25)12-19(16)35-22/h4-7,12-13H,2-3,8-11H2,1H3,(H2,28,29,33,34) |
| InChIKey | IEKLMLOQWMQUIM-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.97 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|