C19H16Cl2N2OS2 — CID 3939700
3,6-dichloro-N-[(4-propan-2-ylphenyl)carbamothioyl]-1-benzothiophene-2-carboxamide (PubChem CID 3939700) has the molecular formula C19H16Cl2N2OS2 and a molecular weight of 423.39 g/mol. Its IUPAC name is 3,6-dichloro-N-[(4-propan-2-ylphenyl)carbamothioyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3,6-dichloro-N-[(4-propan-2-ylphenyl)carbamothioyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 3939700 |
| Molecular Formula | C19H16Cl2N2OS2 |
| Molecular Weight | 423.39 g/mol |
| Exact Mass | 422.01 |
| IUPAC Name | 3,6-dichloro-N-[(4-propan-2-ylphenyl)carbamothioyl]-1-benzothiophene-2-carboxamide |
| SMILES | CC(C)c1ccc(NC(=S)NC(=O)c2sc3cc(Cl)ccc3c2Cl)cc1 |
| InChI | InChI=1S/C19H16Cl2N2OS2/c1-10(2)11-3-6-13(7-4-11)22-19(25)23-18(24)17-16(21)14-8-5-12(20)9-15(14)26-17/h3-10H,1-2H3,(H2,22,23,24,25) |
| InChIKey | QXNYLFNMTNQACC-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.39 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|