C22H24Cl2N2OS2 — CID 124550131
N-[[(1R)-1-(1-adamantyl)ethyl]carbamothioyl]-3,6-dichloro-1-benzothiophene-2-carboxamide (PubChem CID 124550131) has the molecular formula C22H24Cl2N2OS2 and a molecular weight of 467.49 g/mol. Its IUPAC name is N-[[(1R)-1-(1-adamantyl)ethyl]carbamothioyl]-3,6-dichloro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[[(1R)-1-(1-adamantyl)ethyl]carbamothioyl]-3,6-dichloro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 124550131 |
| Molecular Formula | C22H24Cl2N2OS2 |
| Molecular Weight | 467.49 g/mol |
| Exact Mass | 466.07 |
| IUPAC Name | N-[[(1R)-1-(1-adamantyl)ethyl]carbamothioyl]-3,6-dichloro-1-benzothiophene-2-carboxamide |
| SMILES | C[C@@H](NC(=S)NC(=O)c1sc2cc(Cl)ccc2c1Cl)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H24Cl2N2OS2/c1-11(22-8-12-4-13(9-22)6-14(5-12)10-22)25-21(28)26-20(27)19-18(24)16-3-2-15(23)7-17(16)29-19/h2-3,7,11-14H,4-6,8-10H2,1H3,(H2,25,26,27,28)/t11-,12?,13?,14?,22?/m1/s1 |
| InChIKey | BJILMTQJEXJNOH-IURGJNOSSA-N |
| XLogP | 6.42 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.49 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|