C21H26N2O3S — CID 39381189
N-[[(1R)-1-(1-adamantyl)ethyl]carbamothioyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 39381189) has the molecular formula C21H26N2O3S and a molecular weight of 386.52 g/mol. Its IUPAC name is N-[[(1R)-1-(1-adamantyl)ethyl]carbamothioyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[[(1R)-1-(1-adamantyl)ethyl]carbamothioyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 39381189 |
| Molecular Formula | C21H26N2O3S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | N-[[(1R)-1-(1-adamantyl)ethyl]carbamothioyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | C[C@@H](NC(=S)NC(=O)c1ccc2c(c1)OCO2)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H26N2O3S/c1-12(21-8-13-4-14(9-21)6-15(5-13)10-21)22-20(27)23-19(24)16-2-3-17-18(7-16)26-11-25-17/h2-3,7,12-15H,4-6,8-11H2,1H3,(H2,22,23,24,27)/t12-,13?,14?,15?,21?/m1/s1 |
| InChIKey | ASYYSKGXCCMTCR-CSNVJCEJSA-N |
| XLogP | 3.62 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|