C24H27BrN2OS — CID 40950709
N-[[(1S)-1-(1-adamantyl)ethyl]carbamothioyl]-5-bromonaphthalene-1-carboxamide (PubChem CID 40950709) has the molecular formula C24H27BrN2OS and a molecular weight of 471.46 g/mol. Its IUPAC name is N-[[(1S)-1-(1-adamantyl)ethyl]carbamothioyl]-5-bromonaphthalene-1-carboxamide.
| Compound Name | N-[[(1S)-1-(1-adamantyl)ethyl]carbamothioyl]-5-bromonaphthalene-1-carboxamide |
|---|---|
| PubChem CID | 40950709 |
| Molecular Formula | C24H27BrN2OS |
| Molecular Weight | 471.46 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | N-[[(1S)-1-(1-adamantyl)ethyl]carbamothioyl]-5-bromonaphthalene-1-carboxamide |
| SMILES | C[C@H](NC(=S)NC(=O)c1cccc2c(Br)cccc12)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H27BrN2OS/c1-14(24-11-15-8-16(12-24)10-17(9-15)13-24)26-23(29)27-22(28)20-6-2-5-19-18(20)4-3-7-21(19)25/h2-7,14-17H,8-13H2,1H3,(H2,26,27,28,29)/t14-,15?,16?,17?,24?/m0/s1 |
| InChIKey | VMNCXZSTUODGJH-IOAHRDFVSA-N |
| XLogP | 5.81 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.46 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|