C20H25BrN2OS — CID 7311411
N-[[(1S)-1-(1-adamantyl)ethyl]carbamothioyl]-2-bromobenzamide (PubChem CID 7311411) has the molecular formula C20H25BrN2OS and a molecular weight of 421.40 g/mol. Its IUPAC name is N-[[(1S)-1-(1-adamantyl)ethyl]carbamothioyl]-2-bromobenzamide.
| Compound Name | N-[[(1S)-1-(1-adamantyl)ethyl]carbamothioyl]-2-bromobenzamide |
|---|---|
| PubChem CID | 7311411 |
| Molecular Formula | C20H25BrN2OS |
| Molecular Weight | 421.40 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | N-[[(1S)-1-(1-adamantyl)ethyl]carbamothioyl]-2-bromobenzamide |
| SMILES | C[C@H](NC(=S)NC(=O)c1ccccc1Br)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H25BrN2OS/c1-12(20-9-13-6-14(10-20)8-15(7-13)11-20)22-19(25)23-18(24)16-4-2-3-5-17(16)21/h2-5,12-15H,6-11H2,1H3,(H2,22,23,24,25)/t12-,13?,14?,15?,20?/m0/s1 |
| InChIKey | CXZWOLXGJIBDCG-PGBBXINNSA-N |
| XLogP | 4.66 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.40 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|