C20H28N2O3S — CID 94792798
N-[(1S)-1-(1-adamantyl)ethyl]-2-(methanesulfonamido)benzamide (PubChem CID 94792798) has the molecular formula C20H28N2O3S and a molecular weight of 376.52 g/mol. Its IUPAC name is N-[(1S)-1-(1-adamantyl)ethyl]-2-(methanesulfonamido)benzamide.
| Compound Name | N-[(1S)-1-(1-adamantyl)ethyl]-2-(methanesulfonamido)benzamide |
|---|---|
| PubChem CID | 94792798 |
| Molecular Formula | C20H28N2O3S |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | N-[(1S)-1-(1-adamantyl)ethyl]-2-(methanesulfonamido)benzamide |
| SMILES | C[C@H](NC(=O)c1ccccc1NS(C)(=O)=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H28N2O3S/c1-13(20-10-14-7-15(11-20)9-16(8-14)12-20)21-19(23)17-5-3-4-6-18(17)22-26(2,24)25/h3-6,13-16,22H,7-12H2,1-2H3,(H,21,23)/t13-,14?,15?,16?,20?/m0/s1 |
| InChIKey | NHLBUCLQTVWDOY-IVKJLDKCSA-N |
| XLogP | 3.39 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |