C19H23F2NO — CID 7689217
N-[(1R)-1-(1-adamantyl)ethyl]-2,4-difluorobenzamide (PubChem CID 7689217) has the molecular formula C19H23F2NO and a molecular weight of 319.39 g/mol. Its IUPAC name is N-[(1R)-1-(1-adamantyl)ethyl]-2,4-difluorobenzamide.
| Compound Name | N-[(1R)-1-(1-adamantyl)ethyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 7689217 |
| Molecular Formula | C19H23F2NO |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | N-[(1R)-1-(1-adamantyl)ethyl]-2,4-difluorobenzamide |
| SMILES | C[C@@H](NC(=O)c1ccc(F)cc1F)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H23F2NO/c1-11(22-18(23)16-3-2-15(20)7-17(16)21)19-8-12-4-13(9-19)6-14(5-12)10-19/h2-3,7,11-14H,4-6,8-10H2,1H3,(H,22,23)/t11-,12?,13?,14?,19?/m1/s1 |
| InChIKey | LGFWOLQFIXRTAL-UZNLNLPZSA-N |
| XLogP | 4.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |