C20H26FNO — CID 18076207
N-[1-(1-adamantyl)ethyl]-2-(3-fluorophenyl)acetamide (PubChem CID 18076207) has the molecular formula C20H26FNO and a molecular weight of 315.43 g/mol. Its IUPAC name is N-[1-(1-adamantyl)ethyl]-2-(3-fluorophenyl)acetamide.
| Compound Name | N-[1-(1-adamantyl)ethyl]-2-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 18076207 |
| Molecular Formula | C20H26FNO |
| Molecular Weight | 315.43 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | N-[1-(1-adamantyl)ethyl]-2-(3-fluorophenyl)acetamide |
| SMILES | CC(NC(=O)Cc1cccc(F)c1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H26FNO/c1-13(22-19(23)9-14-3-2-4-18(21)8-14)20-10-15-5-16(11-20)7-17(6-15)12-20/h2-4,8,13,15-17H,5-7,9-12H2,1H3,(H,22,23) |
| InChIKey | MJISSDQBPJRHCC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.43 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |