C20H25ClFNO — CID 7929622
N-[(1S)-1-(1-adamantyl)ethyl]-2-(2-chloro-6-fluorophenyl)acetamide (PubChem CID 7929622) has the molecular formula C20H25ClFNO and a molecular weight of 349.88 g/mol. Its IUPAC name is N-[(1S)-1-(1-adamantyl)ethyl]-2-(2-chloro-6-fluorophenyl)acetamide.
| Compound Name | N-[(1S)-1-(1-adamantyl)ethyl]-2-(2-chloro-6-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 7929622 |
| Molecular Formula | C20H25ClFNO |
| Molecular Weight | 349.88 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | N-[(1S)-1-(1-adamantyl)ethyl]-2-(2-chloro-6-fluorophenyl)acetamide |
| SMILES | C[C@H](NC(=O)Cc1c(F)cccc1Cl)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H25ClFNO/c1-12(20-9-13-5-14(10-20)7-15(6-13)11-20)23-19(24)8-16-17(21)3-2-4-18(16)22/h2-4,12-15H,5-11H2,1H3,(H,23,24)/t12-,13?,14?,15?,20?/m0/s1 |
| InChIKey | XCXRPGKAXYXCQQ-PGBBXINNSA-N |
| XLogP | 4.74 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.88 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |