C20H26ClNO — CID 7323929
N-[(1S)-1-(1-adamantyl)ethyl]-2-(4-chlorophenyl)acetamide (PubChem CID 7323929) has the molecular formula C20H26ClNO and a molecular weight of 331.89 g/mol. Its IUPAC name is N-[(1S)-1-(1-adamantyl)ethyl]-2-(4-chlorophenyl)acetamide.
| Compound Name | N-[(1S)-1-(1-adamantyl)ethyl]-2-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 7323929 |
| Molecular Formula | C20H26ClNO |
| Molecular Weight | 331.89 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | N-[(1S)-1-(1-adamantyl)ethyl]-2-(4-chlorophenyl)acetamide |
| SMILES | C[C@H](NC(=O)Cc1ccc(Cl)cc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H26ClNO/c1-13(22-19(23)9-14-2-4-18(21)5-3-14)20-10-15-6-16(11-20)8-17(7-15)12-20/h2-5,13,15-17H,6-12H2,1H3,(H,22,23)/t13-,15?,16?,17?,20?/m0/s1 |
| InChIKey | QMUSXEVVGOSOSK-UGFPPAMCSA-N |
| XLogP | 4.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.89 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |