C22H28ClNO3 — CID 7750244
[2-[[(1R)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2-(4-chlorophenyl)acetate (PubChem CID 7750244) has the molecular formula C22H28ClNO3 and a molecular weight of 389.92 g/mol. Its IUPAC name is [2-[[(1R)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2-(4-chlorophenyl)acetate.
| Compound Name | [2-[[(1R)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2-(4-chlorophenyl)acetate |
|---|---|
| PubChem CID | 7750244 |
| Molecular Formula | C22H28ClNO3 |
| Molecular Weight | 389.92 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | [2-[[(1R)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2-(4-chlorophenyl)acetate |
| SMILES | C[C@@H](NC(=O)COC(=O)Cc1ccc(Cl)cc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H28ClNO3/c1-14(22-10-16-6-17(11-22)8-18(7-16)12-22)24-20(25)13-27-21(26)9-15-2-4-19(23)5-3-15/h2-5,14,16-18H,6-13H2,1H3,(H,24,25)/t14-,16?,17?,18?,22?/m1/s1 |
| InChIKey | GFMOCEZXXSVQKC-YMXMSLLWSA-N |
| XLogP | 4.15 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.92 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |