C25H33NO5 — CID 8534676
[2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2-(5-acetyl-2-methoxyphenyl)acetate (PubChem CID 8534676) has the molecular formula C25H33NO5 and a molecular weight of 427.54 g/mol. Its IUPAC name is [2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2-(5-acetyl-2-methoxyphenyl)acetate.
| Compound Name | [2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2-(5-acetyl-2-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 8534676 |
| Molecular Formula | C25H33NO5 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | [2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2-(5-acetyl-2-methoxyphenyl)acetate |
| SMILES | COc1ccc(C(C)=O)cc1CC(=O)OCC(=O)N[C@@H](C)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C25H33NO5/c1-15(27)20-4-5-22(30-3)21(9-20)10-24(29)31-14-23(28)26-16(2)25-11-17-6-18(12-25)8-19(7-17)13-25/h4-5,9,16-19H,6-8,10-14H2,1-3H3,(H,26,28)/t16-,17?,18?,19?,25?/m0/s1 |
| InChIKey | RFJMHGJJZPEINS-DUXBZUBYSA-N |
| XLogP | 3.70 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |