C24H33NO4 — CID 7871042
[2-[[(1R)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 3-(2-methoxyphenyl)propanoate (PubChem CID 7871042) has the molecular formula C24H33NO4 and a molecular weight of 399.53 g/mol. Its IUPAC name is [2-[[(1R)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 3-(2-methoxyphenyl)propanoate.
| Compound Name | [2-[[(1R)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 3-(2-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 7871042 |
| Molecular Formula | C24H33NO4 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | [2-[[(1R)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 3-(2-methoxyphenyl)propanoate |
| SMILES | COc1ccccc1CCC(=O)OCC(=O)N[C@H](C)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H33NO4/c1-16(24-12-17-9-18(13-24)11-19(10-17)14-24)25-22(26)15-29-23(27)8-7-20-5-3-4-6-21(20)28-2/h3-6,16-19H,7-15H2,1-2H3,(H,25,26)/t16-,17?,18?,19?,24?/m1/s1 |
| InChIKey | JMCQSPKWSQPYHZ-NXTQRVMMSA-N |
| XLogP | 3.89 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |