C22H28BrNO4 — CID 32736381
[2-[(2-methoxyphenyl)methylamino]-2-oxoethyl] (2S)-2-(1-adamantyl)-2-bromoacetate (PubChem CID 32736381) has the molecular formula C22H28BrNO4 and a molecular weight of 450.37 g/mol. Its IUPAC name is [2-[(2-methoxyphenyl)methylamino]-2-oxoethyl] (2S)-2-(1-adamantyl)-2-bromoacetate.
| Compound Name | [2-[(2-methoxyphenyl)methylamino]-2-oxoethyl] (2S)-2-(1-adamantyl)-2-bromoacetate |
|---|---|
| PubChem CID | 32736381 |
| Molecular Formula | C22H28BrNO4 |
| Molecular Weight | 450.37 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | [2-[(2-methoxyphenyl)methylamino]-2-oxoethyl] (2S)-2-(1-adamantyl)-2-bromoacetate |
| SMILES | COc1ccccc1CNC(=O)COC(=O)[C@@H](Br)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H28BrNO4/c1-27-18-5-3-2-4-17(18)12-24-19(25)13-28-21(26)20(23)22-9-14-6-15(10-22)8-16(7-14)11-22/h2-5,14-16,20H,6-13H2,1H3,(H,24,25)/t14?,15?,16?,20-,22?/m1/s1 |
| InChIKey | JQTNLQQEJLCITN-AIRYCRCHSA-N |
| XLogP | 3.83 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.37 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|