C25H32N2O3S — CID 25361859
[2-[[(1R)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 4-(1,3-benzothiazol-2-yl)butanoate (PubChem CID 25361859) has the molecular formula C25H32N2O3S and a molecular weight of 440.61 g/mol. Its IUPAC name is [2-[[(1R)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 4-(1,3-benzothiazol-2-yl)butanoate.
| Compound Name | [2-[[(1R)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 4-(1,3-benzothiazol-2-yl)butanoate |
|---|---|
| PubChem CID | 25361859 |
| Molecular Formula | C25H32N2O3S |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | [2-[[(1R)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 4-(1,3-benzothiazol-2-yl)butanoate |
| SMILES | C[C@@H](NC(=O)COC(=O)CCCc1nc2ccccc2s1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C25H32N2O3S/c1-16(25-12-17-9-18(13-25)11-19(10-17)14-25)26-22(28)15-30-24(29)8-4-7-23-27-20-5-2-3-6-21(20)31-23/h2-3,5-6,16-19H,4,7-15H2,1H3,(H,26,28)/t16-,17?,18?,19?,25?/m1/s1 |
| InChIKey | KECORSVFEOFXKK-ASXFNGKXSA-N |
| XLogP | 4.88 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |