C21H27NO4 — CID 16540227
[2-[1-(1-adamantyl)ethylamino]-2-oxoethyl] 2-hydroxybenzoate (PubChem CID 16540227) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is [2-[1-(1-adamantyl)ethylamino]-2-oxoethyl] 2-hydroxybenzoate.
| Compound Name | [2-[1-(1-adamantyl)ethylamino]-2-oxoethyl] 2-hydroxybenzoate |
|---|---|
| PubChem CID | 16540227 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | [2-[1-(1-adamantyl)ethylamino]-2-oxoethyl] 2-hydroxybenzoate |
| SMILES | CC(NC(=O)COC(=O)c1ccccc1O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H27NO4/c1-13(21-9-14-6-15(10-21)8-16(7-14)11-21)22-19(24)12-26-20(25)17-4-2-3-5-18(17)23/h2-5,13-16,23H,6-12H2,1H3,(H,22,24) |
| InChIKey | OBFZVPRWFGISJF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |